Products 228862-97-3
CAS 228862-97-3 is the registry number for 1-Amino-2,5-anhydro-1-deoxy-D-mannitol. Offered by: TRC, Biosynth, MedChemExpress. Available pack sizes: 10mg, 2mg, 1mg, 5mg, 20mg, 10 mg.
(2R,3S,4S,5R)-2-(aminomethyl)-5-(hydroxymethyl)oxolane-3,4-diol (CAS 228862-97-3) is a chemical compound with the molecular formula C6H13NO4 and a molecular weight of 163.17 g/mol. IUPAC name: (2R,3S,4S,5R)-2-(aminomethyl)-5-(hydroxymethyl)oxolane-3,4-diol. InChIKey: IKPYGNYNWRCKKG-KVTDHHQDSA-N.
| Molecular formula | C6H13NO4 |
|---|---|
| Molecular weight | 163.17 g/mol |
| IUPAC name | (2R,3S,4S,5R)-2-(aminomethyl)-5-(hydroxymethyl)oxolane-3,4-diol |
| InChIKey | IKPYGNYNWRCKKG-KVTDHHQDSA-N |
| SMILES | C([C@@H]1[C@H]([C@@H]([C@H](O1)CO)O)O)N |
Computed by PubChem (NCBI)