Products 228868-39-1
CAS 228868-39-1 is the registry number for tert-butyl (2R)-2-(hydroxymethyl)-3,3-dimethylazetidine-1-carboxylate, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg.
Tert-butyl (2R)-2-(hydroxymethyl)-3,3-dimethylazetidine-1-carboxylate (CAS 228868-39-1) is a chemical compound with the molecular formula C11H21NO3 and a molecular weight of 215.29 g/mol. IUPAC name: tert-butyl (2R)-2-(hydroxymethyl)-3,3-dimethylazetidine-1-carboxylate. InChIKey: AKTHVEPVLSXJQD-QMMMGPOBSA-N.
| Molecular formula | C11H21NO3 |
|---|---|
| Molecular weight | 215.29 g/mol |
| IUPAC name | tert-butyl (2R)-2-(hydroxymethyl)-3,3-dimethylazetidine-1-carboxylate |
| InChIKey | AKTHVEPVLSXJQD-QMMMGPOBSA-N |
| SMILES | CC1(CN([C@H]1CO)C(=O)OC(C)(C)C)C |
Computed by PubChem (NCBI)