CAS 2288709-82-8 is the registry number for 1-{[6-(Benzyloxy)-1H-indol-3-yl]methyl}-1,2,3-benzotriazole, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
1-[(6-phenylmethoxy-1H-indol-3-yl)methyl]benzotriazole (CAS 2288709-82-8) is a chemical compound with the molecular formula C22H18N4O and a molecular weight of 354.4 g/mol. IUPAC name: 1-[(6-phenylmethoxy-1H-indol-3-yl)methyl]benzotriazole. InChIKey: NEIGWBPKSFDTPH-UHFFFAOYSA-N.
| Molecular formula | C22H18N4O |
|---|---|
| Molecular weight | 354.4 g/mol |
| IUPAC name | 1-[(6-phenylmethoxy-1H-indol-3-yl)methyl]benzotriazole |
| InChIKey | NEIGWBPKSFDTPH-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=CC3=C(C=C2)C(=CN3)CN4C5=CC=CC=C5N=N4 |
Computed by PubChem (NCBI)