Products 2289707-21-5
CAS 2289707-21-5 is the registry number for 4-Methoxybenzylamine-d3. Offered by: MedChemExpress. Available pack sizes: 1 mg, 10 mg, 5 mg.
[4-(trideuteriomethoxy)phenyl]methanamine (CAS 2289707-21-5) is a chemical compound with the molecular formula C8H11NO and a molecular weight of 140.20 g/mol. IUPAC name: [4-(trideuteriomethoxy)phenyl]methanamine. InChIKey: IDPURXSQCKYKIJ-FIBGUPNXSA-N.
| Molecular formula | C8H11NO |
|---|---|
| Molecular weight | 140.20 g/mol |
| IUPAC name | [4-(trideuteriomethoxy)phenyl]methanamine |
| InChIKey | IDPURXSQCKYKIJ-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])OC1=CC=C(C=C1)CN |
Computed by PubChem (NCBI)