CAS 2289714-16-3 appears in our catalog under these names: Medetomidine Impurity 46, Medetomidine Impurity 19. Offered by: Chemat Brand. Available pack sizes: on request.
4-[(1S)-1-(2,3-dimethylphenyl)ethyl]-1-ethylimidazole (CAS 2289714-16-3) is a chemical compound with the molecular formula C15H20N2 and a molecular weight of 228.33 g/mol. IUPAC name: 4-[(1S)-1-(2,3-dimethylphenyl)ethyl]-1-ethylimidazole. InChIKey: QUNXMEPJNYGHQA-ZDUSSCGKSA-N.
| Molecular formula | C15H20N2 |
|---|---|
| Molecular weight | 228.33 g/mol |
| IUPAC name | 4-[(1S)-1-(2,3-dimethylphenyl)ethyl]-1-ethylimidazole |
| InChIKey | QUNXMEPJNYGHQA-ZDUSSCGKSA-N |
| SMILES | CCN1C=C(N=C1)[C@@H](C)C2=CC=CC(=C2C)C |
Computed by PubChem (NCBI)