CAS 2289728-58-9 appears in our catalog under these names: Enpp-1-in-1, 95%, Enpp-1-IN-1/ 100%, Enpp–1–IN–1, Enpp-1-IN-1 99%, N-[4-(7-Methoxyquinolin-4-yl)benzyl]sulfamide, 99%, 99%. Offered by: Combi-blocks, TargetMol, GLPBio, Ambeed, Chemat. Available pack sizes: 100mg, 1mg, 5mg, 10mg, 25mg, 50mg, 10mM (in 1ml dmso), 250mg.
7-methoxy-4-[4-[(sulfamoylamino)methyl]phenyl]quinoline (CAS 2289728-58-9) is a chemical compound with the molecular formula C17H17N3O3S and a molecular weight of 343.4 g/mol. IUPAC name: 7-methoxy-4-[4-[(sulfamoylamino)methyl]phenyl]quinoline. InChIKey: UEJMNZDIQDULLP-UHFFFAOYSA-N.
| Molecular formula | C17H17N3O3S |
|---|---|
| Molecular weight | 343.4 g/mol |
| IUPAC name | 7-methoxy-4-[4-[(sulfamoylamino)methyl]phenyl]quinoline |
| InChIKey | UEJMNZDIQDULLP-UHFFFAOYSA-N |
| SMILES | COC1=CC2=NC=CC(=C2C=C1)C3=CC=C(C=C3)CNS(=O)(=O)N |
Computed by PubChem (NCBI)