CAS 229002-10-2 appears in our catalog under these names: MAPK13–IN–1, MAPK13-IN-1, 98%, MAPK13-IN-1/ 99.55% (existing batch purity), MAPK13-IN-1, MAPK13-IN-1, 98.88%. Offered by: GLPBio, AmBeed, TargetMol, Biosynth, Chemat. Available pack sizes: 10mg, 100mg, 1mg, 2mg, 5mg, 25mg, 50mg, 500mg.
1-(3-tert-butyl-1-methylpyrazol-5-yl)-3-(4-pyridin-4-yloxyphenyl)urea (CAS 229002-10-2) is a chemical compound with the molecular formula C20H23N5O2 and a molecular weight of 365.4 g/mol. IUPAC name: 1-(3-tert-butyl-1-methylpyrazol-5-yl)-3-(4-pyridin-4-yloxyphenyl)urea. InChIKey: MHSLDASSAFCCDO-UHFFFAOYSA-N.
| Molecular formula | C20H23N5O2 |
|---|---|
| Molecular weight | 365.4 g/mol |
| IUPAC name | 1-(3-tert-butyl-1-methylpyrazol-5-yl)-3-(4-pyridin-4-yloxyphenyl)urea |
| InChIKey | MHSLDASSAFCCDO-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=NN(C(=C1)NC(=O)NC2=CC=C(C=C2)OC3=CC=NC=C3)C |
Computed by PubChem (NCBI)