Products 2290534-93-7
CAS 2290534-93-7 is the registry number for MmpL3-IN-1. Offered by: MedChemExpress. Available pack sizes: Get quote.
N-(2-adamantyl)-4-(2,6-difluoro-3-pyridinyl)-1H-pyrrole-2-carboxamide (CAS 2290534-93-7) is a chemical compound with the molecular formula C20H21F2N3O and a molecular weight of 357.4 g/mol. IUPAC name: N-(2-adamantyl)-4-(2,6-difluoro-3-pyridinyl)-1H-pyrrole-2-carboxamide. InChIKey: DWGDVELBEXGGDR-UHFFFAOYSA-N.
| Molecular formula | C20H21F2N3O |
|---|---|
| Molecular weight | 357.4 g/mol |
| IUPAC name | N-(2-adamantyl)-4-(2,6-difluoro-3-pyridinyl)-1H-pyrrole-2-carboxamide |
| InChIKey | DWGDVELBEXGGDR-UHFFFAOYSA-N |
| SMILES | C1C2CC3CC1CC(C2)C3NC(=O)C4=CC(=CN4)C5=C(N=C(C=C5)F)F |
Computed by PubChem (NCBI)
Synonyms:
MmpL3-IN-1, orb1688734