CAS 2290561-93-0 appears in our catalog under these names: Phenoxathiin-4-boronic acid pinacol ester, 95%, 4,4,5,5-Tetramethyl-2-(phenoxathiin-4-yl)-1,3,2-dioxaborolane 98%, Phenoxathiin-4-boronic acid pinacol ester, 98%,RG, 98%,RG, 4,4,5,5-Tetramethyl-2-(phenoxathiin-4-yl)-1,3,2-dioxaborolane. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 10g, 5g, 25g, 250mg, 1g, 100mg.
4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxathiine (CAS 2290561-93-0) is a chemical compound with the molecular formula C18H19BO3S and a molecular weight of 326.2 g/mol. IUPAC name: 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxathiine. InChIKey: RXDGSPKRMAWRAL-UHFFFAOYSA-N.
| Molecular formula | C18H19BO3S |
|---|---|
| Molecular weight | 326.2 g/mol |
| IUPAC name | 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxathiine |
| InChIKey | RXDGSPKRMAWRAL-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C3C(=CC=C2)SC4=CC=CC=C4O3 |
Computed by PubChem (NCBI)