CAS 22919-26-2 appears in our catalog under these names: 4-Methylumbelliferyl phosphate disodium salt, 95%, 4–Methylumbelliferyl phosphate disodium salt, 4-Methylumbelliferyl phosphate, disodium salt trihydrate, 4-Methylumbelliferyl phosphate disodium salt, 98.00%, Sodium 4-methyl-2-oxo-2H-chromen-7-yl phosphate, 98%, 98%. Offered by: Combi-blocks, GLPBio, Biosynth, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 250mg, 2g, 10g, 25g, 50g, 100mg.
Disodium;(4-methyl-2-oxochromen-7-yl) phosphate (CAS 22919-26-2) is a chemical compound with the molecular formula C10H7Na2O6P and a molecular weight of 300.11 g/mol. IUPAC name: disodium;(4-methyl-2-oxochromen-7-yl) phosphate. InChIKey: WUUDJQVNZPEPKN-UHFFFAOYSA-L.
| Molecular formula | C10H7Na2O6P |
|---|---|
| Molecular weight | 300.11 g/mol |
| IUPAC name | disodium;(4-methyl-2-oxochromen-7-yl) phosphate |
| InChIKey | WUUDJQVNZPEPKN-UHFFFAOYSA-L |
| SMILES | CC1=CC(=O)OC2=C1C=CC(=C2)OP(=O)([O-])[O-].[Na+].[Na+] |
Computed by PubChem (NCBI)