Products 2293131-41-4
CAS 2293131-41-4 is the registry number for 4-(2-Isopropoxypropan-2-yl)thiazol-2-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-(2-propan-2-yloxypropan-2-yl)-1,3-thiazol-2-amine (CAS 2293131-41-4) is a chemical compound with the molecular formula C9H16N2OS and a molecular weight of 200.30 g/mol. IUPAC name: 4-(2-propan-2-yloxypropan-2-yl)-1,3-thiazol-2-amine. InChIKey: CUMHUCOGYXJURA-UHFFFAOYSA-N.
| Molecular formula | C9H16N2OS |
|---|---|
| Molecular weight | 200.30 g/mol |
| IUPAC name | 4-(2-propan-2-yloxypropan-2-yl)-1,3-thiazol-2-amine |
| InChIKey | CUMHUCOGYXJURA-UHFFFAOYSA-N |
| SMILES | CC(C)OC(C)(C)C1=CSC(=N1)N |
Computed by PubChem (NCBI)