Products 2293250-95-8

CAS 2293250-95-8 is the registry number for 3-(2,2-Difluorocyclopropyl)propiolic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

3-(2,2-difluorocyclopropyl)prop-2-ynoic acid (CAS 2293250-95-8) is a chemical compound with the molecular formula C6H4F2O2 and a molecular weight of 146.09 g/mol. IUPAC name: 3-(2,2-difluorocyclopropyl)prop-2-ynoic acid. InChIKey: MSFQCLPVAHXMND-UHFFFAOYSA-N.

Identity
Molecular formulaC6H4F2O2
Molecular weight146.09 g/mol
IUPAC name3-(2,2-difluorocyclopropyl)prop-2-ynoic acid
InChIKeyMSFQCLPVAHXMND-UHFFFAOYSA-N
SMILESC1C(C1(F)F)C#CC(=O)O

Computed by PubChem (NCBI)