Products 22934-35-6
CAS 22934-35-6 appears in our catalog under these names: 3-Ethyl-4-methoxybenzoic acid, 95%, 3-Ethyl-4-methoxybenzoic acid, 98%, 3-Ethyl-4-methoxybenzoic acid, 3-Ethyl-4-methoxybenzoic acid, ≥95%, ≥95%, 3-Ethyl-4-methoxybenzoic acid, ≥95%. Offered by: Combi-blocks, AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 10g, 5g, 250mg, 1g, 0,5g, 50mg.
3-ethyl-4-methoxybenzoic acid (CAS 22934-35-6) is a chemical compound with the molecular formula C10H12O3 and a molecular weight of 180.20 g/mol. IUPAC name: 3-ethyl-4-methoxybenzoic acid. InChIKey: FPHXIFFANOEDCL-UHFFFAOYSA-N.
| Molecular formula | C10H12O3 |
|---|---|
| Molecular weight | 180.20 g/mol |
| IUPAC name | 3-ethyl-4-methoxybenzoic acid |
| InChIKey | FPHXIFFANOEDCL-UHFFFAOYSA-N |
| SMILES | CCC1=C(C=CC(=C1)C(=O)O)OC |
Computed by PubChem (NCBI)