Products 22942-87-6
CAS 22942-87-6 appears in our catalog under these names: 3–Bromoindolin–2–one, 3-Bromoindolin-2-one 98%, 3-Bromoindolin-2-one, 95%, 95%, 3-Bromoindolin-2-one, 95%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g.
3-bromo-1,3-dihydroindol-2-one (CAS 22942-87-6) is a chemical compound with the molecular formula C8H6BrNO and a molecular weight of 212.04 g/mol. IUPAC name: 3-bromo-1,3-dihydroindol-2-one. InChIKey: KQNMNQHOKUHSJP-UHFFFAOYSA-N.
| Molecular formula | C8H6BrNO |
|---|---|
| Molecular weight | 212.04 g/mol |
| IUPAC name | 3-bromo-1,3-dihydroindol-2-one |
| InChIKey | KQNMNQHOKUHSJP-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(C(=O)N2)Br |
Computed by PubChem (NCBI)