Products 2294948-48-2
CAS 2294948-48-2 is the registry number for tert-butyl 2,2,3,3,5,5-hexadeuterio-4-oxo-pyrrolidine-1-carboxylate, 97%, 97%. Offered by: Chemat. Available pack sizes: 1g.
Tert-butyl 2,2,3,3,5,5-hexadeuterio-4-oxopyrrolidine-1-carboxylate (CAS 2294948-48-2) is a chemical compound with the molecular formula C9H15NO3 and a molecular weight of 191.26 g/mol. IUPAC name: tert-butyl 2,2,3,3,5,5-hexadeuterio-4-oxopyrrolidine-1-carboxylate. InChIKey: JSOMVCDXPUXKIC-KETLRHEYSA-N.
| Molecular formula | C9H15NO3 |
|---|---|
| Molecular weight | 191.26 g/mol |
| IUPAC name | tert-butyl 2,2,3,3,5,5-hexadeuterio-4-oxopyrrolidine-1-carboxylate |
| InChIKey | JSOMVCDXPUXKIC-KETLRHEYSA-N |
| SMILES | [2H]C1(C(=O)C(N(C1([2H])[2H])C(=O)OC(C)(C)C)([2H])[2H])[2H] |
Computed by PubChem (NCBI)