Products 2294956-89-9
CAS 2294956-89-9 is the registry number for Tetrahydro-4-pyrone-d8. Offered by: TRC. Available pack sizes: 100mg.
2,2,3,3,5,5,6,6-octadeuteriooxan-4-one (CAS 2294956-89-9) is a chemical compound with the molecular formula C5H8O2 and a molecular weight of 108.16 g/mol. IUPAC name: 2,2,3,3,5,5,6,6-octadeuteriooxan-4-one. InChIKey: JMJRYTGVHCAYCT-SVYQBANQSA-N.
| Molecular formula | C5H8O2 |
|---|---|
| Molecular weight | 108.16 g/mol |
| IUPAC name | 2,2,3,3,5,5,6,6-octadeuteriooxan-4-one |
| InChIKey | JMJRYTGVHCAYCT-SVYQBANQSA-N |
| SMILES | [2H]C1(C(=O)C(C(OC1([2H])[2H])([2H])[2H])([2H])[2H])[2H] |
Computed by PubChem (NCBI)