CAS 22951-96-8 appears in our catalog under these names: H–β–(2–Thienyl)–Ala–OH, 3-(2-Thienyl)-L-alanine, 95% , 3-(2-Thienyl)-L-alanine, >97.0%(HPLC)(T), 3-(2-THIENYL)-L-ALANINE, >=98.0%, (S)-2-Amino-3-(thiophen-2-yl)propanoic acid, 97%, 97%. Offered by: GLPBio, Thermo Scientific (Alfa Aesar), TCI, Sigma-Aldrich, Chemat. Available pack sizes: 1g, 10g, 25g, 5g, 200mg, 50MG, 250mg, 100g.
(2S)-2-amino-3-thiophen-2-ylpropanoic acid (CAS 22951-96-8) is a chemical compound with the molecular formula C7H9NO2S and a molecular weight of 171.22 g/mol. IUPAC name: (2S)-2-amino-3-thiophen-2-ylpropanoic acid. InChIKey: WTOFYLAWDLQMBZ-LURJTMIESA-N.
| Molecular formula | C7H9NO2S |
|---|---|
| Molecular weight | 171.22 g/mol |
| IUPAC name | (2S)-2-amino-3-thiophen-2-ylpropanoic acid |
| InChIKey | WTOFYLAWDLQMBZ-LURJTMIESA-N |
| SMILES | C1=CSC(=C1)C[C@@H](C(=O)O)N |
Computed by PubChem (NCBI)