CAS 229615-12-7 appears in our catalog under these names: Peramivir Impurity 45, Peramivir Enantiomer, Peramivir Impurity 4, (+)-ent-Peramivir. Offered by: Chemat Brand, Hubei YoungXin, TRC. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
(1R,2R,3R,4S)-3-[(1R)-1-acetamido-2-ethylbutyl]-4-(diaminomethylideneamino)-2-hydroxycyclopentane-1-carboxylic acid (CAS 229615-12-7) is a chemical compound with the molecular formula C15H28N4O4 and a molecular weight of 328.41 g/mol. IUPAC name: (1R,2R,3R,4S)-3-[(1R)-1-acetamido-2-ethylbutyl]-4-(diaminomethylideneamino)-2-hydroxycyclopentane-1-carboxylic acid. InChIKey: XRQDFNLINLXZLB-SJHCENCUSA-N.
| Molecular formula | C15H28N4O4 |
|---|---|
| Molecular weight | 328.41 g/mol |
| IUPAC name | (1R,2R,3R,4S)-3-[(1R)-1-acetamido-2-ethylbutyl]-4-(diaminomethylideneamino)-2-hydroxycyclopentane-1-carboxylic acid |
| InChIKey | XRQDFNLINLXZLB-SJHCENCUSA-N |
| SMILES | CCC(CC)[C@H]([C@@H]1[C@H](C[C@H]([C@@H]1O)C(=O)O)N=C(N)N)NC(=O)C |
Computed by PubChem (NCBI)