CAS 229639-54-7 appears in our catalog under these names: R–(+)–Mono–desmethylsibutramine, R-(+)-Mono-desmethylsibutramine. Offered by: GLPBio, MedChemExpress. Available pack sizes: 10mg, 5mg, Get quote.
(1R)-1-[1-(4-chlorophenyl)cyclobutyl]-N,3-dimethylbutan-1-amine (CAS 229639-54-7) is a chemical compound with the molecular formula C16H24ClN and a molecular weight of 265.82 g/mol. IUPAC name: (1R)-1-[1-(4-chlorophenyl)cyclobutyl]-N,3-dimethylbutan-1-amine. InChIKey: PLXKZKLXYHLWHR-OAHLLOKOSA-N.
| Molecular formula | C16H24ClN |
|---|---|
| Molecular weight | 265.82 g/mol |
| IUPAC name | (1R)-1-[1-(4-chlorophenyl)cyclobutyl]-N,3-dimethylbutan-1-amine |
| InChIKey | PLXKZKLXYHLWHR-OAHLLOKOSA-N |
| SMILES | CC(C)C[C@H](C1(CCC1)C2=CC=C(C=C2)Cl)NC |
Computed by PubChem (NCBI)