CAS 22979-96-0 appears in our catalog under these names: Potassium 2-((2-carboxyphenyl)amino)acetate, 97%, N-(2-Carboxyphenyl)glycine Monopotassium Salt. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 5g.
Potassium 2-(2-carboxyanilino)acetate (CAS 22979-96-0) is a chemical compound with the molecular formula C9H8KNO4 and a molecular weight of 233.26 g/mol. IUPAC name: potassium 2-(2-carboxyanilino)acetate. InChIKey: GJYVLQVTUHSBAT-UHFFFAOYSA-M.
| Molecular formula | C9H8KNO4 |
|---|---|
| Molecular weight | 233.26 g/mol |
| IUPAC name | potassium 2-(2-carboxyanilino)acetate |
| InChIKey | GJYVLQVTUHSBAT-UHFFFAOYSA-M |
| SMILES | C1=CC=C(C(=C1)C(=O)O)NCC(=O)[O-].[K+] |
Computed by PubChem (NCBI)