CAS 22980-76-3 appears in our catalog under these names: 1,10-Phenanthroline nickel (ll) dichloride, 95%, (T–4)–Dichloro(1,10–phenanthroline–κN1,κN10)nickel, Ni(phen)Cl2 98%, 1,10-Phenanthroline nickel (II) dichlor&, (T-4)-Dichloro(1,10-Phenanthroline-Κn1,Κn10)Nickel, 98%, 98%. Offered by: Combi-blocks, GLPBio, Ambeed, Sigma-Aldrich, Chemat. Available pack sizes: 25g, 5g, 1g, 100g, 100mg, 250mg.
Dichloronickel;1,10-phenanthroline (CAS 22980-76-3) is a chemical compound with the molecular formula C12H8Cl2N2Ni and a molecular weight of 309.80 g/mol. IUPAC name: dichloronickel;1,10-phenanthroline. InChIKey: RMTGLTCLJRSHSB-UHFFFAOYSA-L.
| Molecular formula | C12H8Cl2N2Ni |
|---|---|
| Molecular weight | 309.80 g/mol |
| IUPAC name | dichloronickel;1,10-phenanthroline |
| InChIKey | RMTGLTCLJRSHSB-UHFFFAOYSA-L |
| SMILES | C1=CC2=C(C3=C(C=CC=N3)C=C2)N=C1.Cl[Ni]Cl |
Computed by PubChem (NCBI)