CAS 2299199-54-3 is the registry number for Antimalarial agent 24. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-[2-(4-phenyltriazol-1-yl)ethylamino]naphthalene-1,4-dione (CAS 2299199-54-3) is a chemical compound with the molecular formula C20H16N4O2 and a molecular weight of 344.4 g/mol. IUPAC name: 2-[2-(4-phenyltriazol-1-yl)ethylamino]naphthalene-1,4-dione. InChIKey: NHPSSPKUVSQOSV-UHFFFAOYSA-N.
| Molecular formula | C20H16N4O2 |
|---|---|
| Molecular weight | 344.4 g/mol |
| IUPAC name | 2-[2-(4-phenyltriazol-1-yl)ethylamino]naphthalene-1,4-dione |
| InChIKey | NHPSSPKUVSQOSV-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CN(N=N2)CCNC3=CC(=O)C4=CC=CC=C4C3=O |
Computed by PubChem (NCBI)