CAS 2300-15-4 is the registry number for 4,4'-((4-hydroxy-1,3-phenylene)bis(propane-2,2-diyl))diphenol, 98%, 98%. Offered by: Chemat. Available pack sizes: 25mg, 50mg, 100mg.
2,4-bis[2-(4-hydroxyphenyl)propan-2-yl]phenol (CAS 2300-15-4) is a chemical compound with the molecular formula C24H26O3 and a molecular weight of 362.5 g/mol. IUPAC name: 2,4-bis[2-(4-hydroxyphenyl)propan-2-yl]phenol. InChIKey: VPVTXVHUJHGOCM-UHFFFAOYSA-N.
| Molecular formula | C24H26O3 |
|---|---|
| Molecular weight | 362.5 g/mol |
| IUPAC name | 2,4-bis[2-(4-hydroxyphenyl)propan-2-yl]phenol |
| InChIKey | VPVTXVHUJHGOCM-UHFFFAOYSA-N |
| SMILES | CC(C)(C1=CC=C(C=C1)O)C2=CC(=C(C=C2)O)C(C)(C)C3=CC=C(C=C3)O |
Computed by PubChem (NCBI)