CAS 2300099-98-1 appears in our catalog under these names: E3 ligase Ligand 32, 98%, E3 ligase Ligand 32, 3-(5-Bromo-3-methyl-2-oxo-2,3-dihydro-1H-benzo[d]imidazol-1-yl)piperidine-2,6-dione, 98%, 98%, E3 ligase Ligand 32, 99.96%, E3 ligase Ligand 32, 96%. Offered by: Ambeed, GLPBio, Chemat, MedChemExpress, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 25g, 100mg, 500mg, 50g, 250g.
3-(5-bromo-3-methyl-2-oxobenzimidazol-1-yl)piperidine-2,6-dione (CAS 2300099-98-1) is a chemical compound with the molecular formula C13H12BrN3O3 and a molecular weight of 338.16 g/mol. IUPAC name: 3-(5-bromo-3-methyl-2-oxobenzimidazol-1-yl)piperidine-2,6-dione. InChIKey: JTRNEHBIODAOTJ-UHFFFAOYSA-N.
| Molecular formula | C13H12BrN3O3 |
|---|---|
| Molecular weight | 338.16 g/mol |
| IUPAC name | 3-(5-bromo-3-methyl-2-oxobenzimidazol-1-yl)piperidine-2,6-dione |
| InChIKey | JTRNEHBIODAOTJ-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C=CC(=C2)Br)N(C1=O)C3CCC(=O)NC3=O |
Computed by PubChem (NCBI)