CAS 2300178-72-5 is the registry number for Kevetrin-13C2,15N3 (hydrochloride). Offered by: MedChemExpress. Available pack sizes: 5mg, 1mg.
3-((15N)azanylidyne(113C)methyl)propyl carbamimidothioate;hydrochloride (CAS 2300178-72-5) is a chemical compound with the molecular formula C5H10ClN3S and a molecular weight of 184.64 g/mol. IUPAC name: 3-((15N)azanylidyne(113C)methyl)propyl carbamimidothioate;hydrochloride. InChIKey: NCXJZJFDQMKRKM-CBWHUSCUSA-N.
| Molecular formula | C5H10ClN3S |
|---|---|
| Molecular weight | 184.64 g/mol |
| IUPAC name | 3-((15N)azanylidyne(113C)methyl)propyl carbamimidothioate;hydrochloride |
| InChIKey | NCXJZJFDQMKRKM-CBWHUSCUSA-N |
| SMILES | C(C[13C]#[15N])CS[13C](=[15NH])[15NH2].Cl |
Computed by PubChem (NCBI)