CAS 2301067-38-7 is the registry number for 1-Bromo-2-(2,2-difluoro-propoxy)-3-fluoro-5-nitro-benzene, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
1-bromo-2-(2,2-difluoropropoxy)-3-fluoro-5-nitrobenzene (CAS 2301067-38-7) is a chemical compound with the molecular formula C9H7BrF3NO3 and a molecular weight of 314.06 g/mol. IUPAC name: 1-bromo-2-(2,2-difluoropropoxy)-3-fluoro-5-nitrobenzene. InChIKey: PORHYFNMYMULLV-UHFFFAOYSA-N.
| Molecular formula | C9H7BrF3NO3 |
|---|---|
| Molecular weight | 314.06 g/mol |
| IUPAC name | 1-bromo-2-(2,2-difluoropropoxy)-3-fluoro-5-nitrobenzene |
| InChIKey | PORHYFNMYMULLV-UHFFFAOYSA-N |
| SMILES | CC(COC1=C(C=C(C=C1Br)[N+](=O)[O-])F)(F)F |
Computed by PubChem (NCBI)