CAS 2301067-53-6 is the registry number for 2-Chloro-6-iodo-3-(2,2,2-trifluoro-ethoxy)-pyridine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
2-chloro-6-iodo-3-(2,2,2-trifluoroethoxy)pyridine (CAS 2301067-53-6) is a chemical compound with the molecular formula C7H4ClF3INO and a molecular weight of 337.46 g/mol. IUPAC name: 2-chloro-6-iodo-3-(2,2,2-trifluoroethoxy)pyridine. InChIKey: XVZUQIGQQCLLLB-UHFFFAOYSA-N.
| Molecular formula | C7H4ClF3INO |
|---|---|
| Molecular weight | 337.46 g/mol |
| IUPAC name | 2-chloro-6-iodo-3-(2,2,2-trifluoroethoxy)pyridine |
| InChIKey | XVZUQIGQQCLLLB-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC(=C1OCC(F)(F)F)Cl)I |
Computed by PubChem (NCBI)