CAS 2301067-64-9 is the registry number for 1-(3-Fluoro-4-trifluoromethoxy-benzyl)-piperazine dihydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
1-[[3-fluoro-4-(trifluoromethoxy)phenyl]methyl]piperazine;dihydrochloride (CAS 2301067-64-9) is a chemical compound with the molecular formula C12H16Cl2F4N2O and a molecular weight of 351.16 g/mol. IUPAC name: 1-[[3-fluoro-4-(trifluoromethoxy)phenyl]methyl]piperazine;dihydrochloride. InChIKey: JUEHTOPAHWZGBL-UHFFFAOYSA-N.
| Molecular formula | C12H16Cl2F4N2O |
|---|---|
| Molecular weight | 351.16 g/mol |
| IUPAC name | 1-[[3-fluoro-4-(trifluoromethoxy)phenyl]methyl]piperazine;dihydrochloride |
| InChIKey | JUEHTOPAHWZGBL-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)CC2=CC(=C(C=C2)OC(F)(F)F)F.Cl.Cl |
Computed by PubChem (NCBI)