CAS 2301067-76-3 is the registry number for 3-Bromo-5-fluoro-4-(2,2,2-trifluoro-ethoxy)-phenylamine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
3-bromo-5-fluoro-4-(2,2,2-trifluoroethoxy)aniline (CAS 2301067-76-3) is a chemical compound with the molecular formula C8H6BrF4NO and a molecular weight of 288.04 g/mol. IUPAC name: 3-bromo-5-fluoro-4-(2,2,2-trifluoroethoxy)aniline. InChIKey: HPQBDRYXLZJLSV-UHFFFAOYSA-N.
| Molecular formula | C8H6BrF4NO |
|---|---|
| Molecular weight | 288.04 g/mol |
| IUPAC name | 3-bromo-5-fluoro-4-(2,2,2-trifluoroethoxy)aniline |
| InChIKey | HPQBDRYXLZJLSV-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1F)OCC(F)(F)F)Br)N |
Computed by PubChem (NCBI)