CAS 2301068-85-7 is the registry number for 4-(2-Bromo-5-nitro-phenoxymethyl)-piperidine-1-carboxylic acid benzyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
Benzyl 4-[(2-bromo-5-nitrophenoxy)methyl]piperidine-1-carboxylate (CAS 2301068-85-7) is a chemical compound with the molecular formula C20H21BrN2O5 and a molecular weight of 449.3 g/mol. IUPAC name: benzyl 4-[(2-bromo-5-nitrophenoxy)methyl]piperidine-1-carboxylate. InChIKey: CGBPAPXEQFWHSC-UHFFFAOYSA-N.
| Molecular formula | C20H21BrN2O5 |
|---|---|
| Molecular weight | 449.3 g/mol |
| IUPAC name | benzyl 4-[(2-bromo-5-nitrophenoxy)methyl]piperidine-1-carboxylate |
| InChIKey | CGBPAPXEQFWHSC-UHFFFAOYSA-N |
| SMILES | C1CN(CCC1COC2=C(C=CC(=C2)[N+](=O)[O-])Br)C(=O)OCC3=CC=CC=C3 |
Computed by PubChem (NCBI)