Products 2301068-85-7

CAS 2301068-85-7 is the registry number for 4-(2-Bromo-5-nitro-phenoxymethyl)-piperidine-1-carboxylic acid benzyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.

Structural formula: {0} (CAS {1})

Benzyl 4-[(2-bromo-5-nitrophenoxy)methyl]piperidine-1-carboxylate (CAS 2301068-85-7) is a chemical compound with the molecular formula C20H21BrN2O5 and a molecular weight of 449.3 g/mol. IUPAC name: benzyl 4-[(2-bromo-5-nitrophenoxy)methyl]piperidine-1-carboxylate. InChIKey: CGBPAPXEQFWHSC-UHFFFAOYSA-N.

Identity
Molecular formulaC20H21BrN2O5
Molecular weight449.3 g/mol
IUPAC namebenzyl 4-[(2-bromo-5-nitrophenoxy)methyl]piperidine-1-carboxylate
InChIKeyCGBPAPXEQFWHSC-UHFFFAOYSA-N
SMILESC1CN(CCC1COC2=C(C=CC(=C2)[N+](=O)[O-])Br)C(=O)OCC3=CC=CC=C3

Computed by PubChem (NCBI)