CAS 2301983-88-8 is the registry number for (R)-2-(tert-Butylamino)-1-(5-fluoropyridin-3-yl)ethan-1-ol, 95%, 95%. Offered by: Chemat. Available pack sizes: 5mg, 10mg, 50mg, 100mg.
(1R)-2-(tert-butylamino)-1-(5-fluoro-3-pyridinyl)ethanol (CAS 2301983-88-8) is a chemical compound with the molecular formula C11H17FN2O and a molecular weight of 212.26 g/mol. IUPAC name: (1R)-2-(tert-butylamino)-1-(5-fluoro-3-pyridinyl)ethanol. InChIKey: SASMSPQPEDQJII-JTQLQIEISA-N.
| Molecular formula | C11H17FN2O |
|---|---|
| Molecular weight | 212.26 g/mol |
| IUPAC name | (1R)-2-(tert-butylamino)-1-(5-fluoro-3-pyridinyl)ethanol |
| InChIKey | SASMSPQPEDQJII-JTQLQIEISA-N |
| SMILES | CC(C)(C)NC[C@@H](C1=CC(=CN=C1)F)O |
Computed by PubChem (NCBI)