CAS 23024-29-5 appears in our catalog under these names: Disuccinimidyl sebacate, 95%, Disuccinimidyl sebacate, Di(N-succinimidyl) Sebacate, >98.0%(HPLC)(N), Sebacic acid bis(N-succinimidyl) ester 98%, Bis(2,5-dioxopyrrolidin-1-yl) decanedioate, 98%, 98%. Offered by: Combi-blocks, GLPBio, TCI, Ambeed, Chemat. Available pack sizes: 25g, 5g, 1g, 100g, 50 g, 5 g, 100 g, 25 g.
Bis(2,5-dioxopyrrolidin-1-yl) decanedioate (CAS 23024-29-5) is a chemical compound with the molecular formula C18H24N2O8 and a molecular weight of 396.4 g/mol. IUPAC name: bis(2,5-dioxopyrrolidin-1-yl) decanedioate. InChIKey: XPKIVYVYXKPGBP-UHFFFAOYSA-N.
| Molecular formula | C18H24N2O8 |
|---|---|
| Molecular weight | 396.4 g/mol |
| IUPAC name | bis(2,5-dioxopyrrolidin-1-yl) decanedioate |
| InChIKey | XPKIVYVYXKPGBP-UHFFFAOYSA-N |
| SMILES | C1CC(=O)N(C1=O)OC(=O)CCCCCCCCC(=O)ON2C(=O)CCC2=O |
Computed by PubChem (NCBI)