CAS 230299-21-5 appears in our catalog under these names: Bis(hexylene glycolato)diboron, Bis(hexylene Glycolato)diboron, >98.0%(GC), 4,4,4',4',6,6'-Hexamethyl-2,2'-bi(1,3,2-dioxaborinane) 98%, BIS(HEXYLENE GLYCOLATO)DIBORON, 96%, 4,4,4',4',6,6'-Hexamethyl-2,2'-bi-1,3,2-dioxaborinane, 98%, 98%. Offered by: GLPBio, TCI, Ambeed, Sigma-Aldrich, Chemat. Available pack sizes: 100g, 25g, 1g, 5g, 10g, 500g.
4,4,6-trimethyl-2-(4,4,6-trimethyl-1,3,2-dioxaborinan-2-yl)-1,3,2-dioxaborinane (CAS 230299-21-5) is a chemical compound with the molecular formula C12H24B2O4 and a molecular weight of 253.9 g/mol. IUPAC name: 4,4,6-trimethyl-2-(4,4,6-trimethyl-1,3,2-dioxaborinan-2-yl)-1,3,2-dioxaborinane. InChIKey: UEBSWKNVDRJVHN-UHFFFAOYSA-N.
| Molecular formula | C12H24B2O4 |
|---|---|
| Molecular weight | 253.9 g/mol |
| IUPAC name | 4,4,6-trimethyl-2-(4,4,6-trimethyl-1,3,2-dioxaborinan-2-yl)-1,3,2-dioxaborinane |
| InChIKey | UEBSWKNVDRJVHN-UHFFFAOYSA-N |
| SMILES | B1(OC(CC(O1)(C)C)C)B2OC(CC(O2)(C)C)C |
Computed by PubChem (NCBI)