Products 230313-75-4
CAS 230313-75-4 is the registry number for Levophencynonate. Offered by: MedChemExpress. Available pack sizes: Get quote.
[(1S,5R)-3-methyl-3-azabicyclo[3.3.1]nonan-9-yl] (2R)-2-cyclopentyl-2-hydroxy-2-phenylacetate (CAS 230313-75-4) is a chemical compound with the molecular formula C22H31NO3 and a molecular weight of 357.5 g/mol. IUPAC name: [(1S,5R)-3-methyl-3-azabicyclo[3.3.1]nonan-9-yl] (2R)-2-cyclopentyl-2-hydroxy-2-phenylacetate. InChIKey: ROZOEEGFKDFEFP-JLPZCGHASA-N.
| Molecular formula | C22H31NO3 |
|---|---|
| Molecular weight | 357.5 g/mol |
| IUPAC name | [(1S,5R)-3-methyl-3-azabicyclo[3.3.1]nonan-9-yl] (2R)-2-cyclopentyl-2-hydroxy-2-phenylacetate |
| InChIKey | ROZOEEGFKDFEFP-JLPZCGHASA-N |
| SMILES | CN1C[C@H]2CCC[C@@H](C1)C2OC(=O)[C@@](C3CCCC3)(C4=CC=CC=C4)O |
Computed by PubChem (NCBI)