CAS 23034-25-5 is the registry number for 1,4-Cyclohexanedione-d8. Offered by: TRC. Available pack sizes: 100mg, 10mg.
2,2,3,3,5,5,6,6-octadeuteriocyclohexane-1,4-dione (CAS 23034-25-5) is a chemical compound with the molecular formula C6H8O2 and a molecular weight of 120.18 g/mol. IUPAC name: 2,2,3,3,5,5,6,6-octadeuteriocyclohexane-1,4-dione. InChIKey: DCZFGQYXRKMVFG-SVYQBANQSA-N.
| Molecular formula | C6H8O2 |
|---|---|
| Molecular weight | 120.18 g/mol |
| IUPAC name | 2,2,3,3,5,5,6,6-octadeuteriocyclohexane-1,4-dione |
| InChIKey | DCZFGQYXRKMVFG-SVYQBANQSA-N |
| SMILES | [2H]C1(C(=O)C(C(C(=O)C1([2H])[2H])([2H])[2H])([2H])[2H])[2H] |
Computed by PubChem (NCBI)