CAS 23035-53-2 appears in our catalog under these names: Dydrogesterone EP Impurity A, Dydrogesterone Impurity 1(Dydrogesterone EP Impurity A), 9β,10α-Pregna-4,6,8(14)-triene-3,20-dione, Dydrogesterone related compound A. Offered by: Chemat Brand, Hubei YoungXin, TRC, Biosynth. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 2mg, 1mg.
(9S,10S,13R,17S)-17-acetyl-10,13-dimethyl-1,2,9,11,12,15,16,17-octahydrocyclopenta[a]phenanthren-3-one (CAS 23035-53-2) is a chemical compound with the molecular formula C21H26O2 and a molecular weight of 310.4 g/mol. IUPAC name: (9S,10S,13R,17S)-17-acetyl-10,13-dimethyl-1,2,9,11,12,15,16,17-octahydrocyclopenta[a]phenanthren-3-one. InChIKey: HMDYHHQZKIYROJ-CWJKEVGVSA-N.
| Molecular formula | C21H26O2 |
|---|---|
| Molecular weight | 310.4 g/mol |
| IUPAC name | (9S,10S,13R,17S)-17-acetyl-10,13-dimethyl-1,2,9,11,12,15,16,17-octahydrocyclopenta[a]phenanthren-3-one |
| InChIKey | HMDYHHQZKIYROJ-CWJKEVGVSA-N |
| SMILES | CC(=O)[C@H]1CCC2=C3C=CC4=CC(=O)CC[C@]4([C@@H]3CC[C@]12C)C |
Computed by PubChem (NCBI)