Products 2303565-97-9

CAS 2303565-97-9 is the registry number for 2-(4-(3-Aminopropyl)-1H-pyrazol-1-yl)ethan-1-ol oxalate, 98%. Offered by: AmBeed. Available pack sizes: 5g, 10g.

Structural formula: {0} (CAS {1})

2-[4-(3-aminopropyl)pyrazol-1-yl]ethanol;oxalic acid (CAS 2303565-97-9) is a chemical compound with the molecular formula C10H17N3O5 and a molecular weight of 259.26 g/mol. IUPAC name: 2-[4-(3-aminopropyl)pyrazol-1-yl]ethanol;oxalic acid. InChIKey: MWQISPVUJVUZAS-UHFFFAOYSA-N.

Identity
Molecular formulaC10H17N3O5
Molecular weight259.26 g/mol
IUPAC name2-[4-(3-aminopropyl)pyrazol-1-yl]ethanol;oxalic acid
InChIKeyMWQISPVUJVUZAS-UHFFFAOYSA-N
SMILESC1=C(C=NN1CCO)CCCN.C(=O)(C(=O)O)O

Computed by PubChem (NCBI)