CAS 2304549-73-1 appears in our catalog under these names: GFB–8438, Gfb-8438, 95%, GFB-8438/ 99.29% (existing batch purity), GFB-8438, GFB-8438 98%. Offered by: GLPBio, Combi-blocks, TargetMol, Biosynth, Ambeed. Available pack sizes: 1mg, 250mg, 100mg, 1g, 5mg, 10mg, 25mg, 50mg.
5-chloro-4-[3-oxo-4-[[2-(trifluoromethyl)phenyl]methyl]piperazin-1-yl]-1H-pyridazin-6-one (CAS 2304549-73-1) is a chemical compound with the molecular formula C16H14ClF3N4O2 and a molecular weight of 386.75 g/mol. IUPAC name: 5-chloro-4-[3-oxo-4-[[2-(trifluoromethyl)phenyl]methyl]piperazin-1-yl]-1H-pyridazin-6-one. InChIKey: MITRKIWBJVJRAM-UHFFFAOYSA-N.
| Molecular formula | C16H14ClF3N4O2 |
|---|---|
| Molecular weight | 386.75 g/mol |
| IUPAC name | 5-chloro-4-[3-oxo-4-[[2-(trifluoromethyl)phenyl]methyl]piperazin-1-yl]-1H-pyridazin-6-one |
| InChIKey | MITRKIWBJVJRAM-UHFFFAOYSA-N |
| SMILES | C1CN(C(=O)CN1C2=C(C(=O)NN=C2)Cl)CC3=CC=CC=C3C(F)(F)F |
Computed by PubChem (NCBI)