CAS 2304558-22-1 appears in our catalog under these names: 20,20-Dimethyl-18-oxo-3,6,9,12,15,19-hexaoxahenicosan-1-oic acid, 95%, Acid-C1-PEG5-Boc, 98%, Acid-C1-PEG5-Boc/ 99.89% (existing batch purity), Acid–C1–PEG5–Boc, 20,20-Dimethyl-18-oxo-3,6,9,12,15,19-hexaoxahenicosan-1-oic acid, 95%, 95%. Offered by: Combi-blocks, AmBeed, TargetMol, GLPBio, Chemat. Available pack sizes: 100mg, 250mg, 5g, 1g, 2mg, 5mg, 10mg, 25mg.
2-[2-[2-[2-[2-[3-[(2-methylpropan-2-yl)oxy]-3-oxopropoxy]ethoxy]ethoxy]ethoxy]ethoxy]acetic acid (CAS 2304558-22-1) is a chemical compound with the molecular formula C17H32O9 and a molecular weight of 380.4 g/mol. IUPAC name: 2-[2-[2-[2-[2-[3-[(2-methylpropan-2-yl)oxy]-3-oxopropoxy]ethoxy]ethoxy]ethoxy]ethoxy]acetic acid. InChIKey: HEXUSUWJDURSOW-UHFFFAOYSA-N.
| Molecular formula | C17H32O9 |
|---|---|
| Molecular weight | 380.4 g/mol |
| IUPAC name | 2-[2-[2-[2-[2-[3-[(2-methylpropan-2-yl)oxy]-3-oxopropoxy]ethoxy]ethoxy]ethoxy]ethoxy]acetic acid |
| InChIKey | HEXUSUWJDURSOW-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)CCOCCOCCOCCOCCOCC(=O)O |
Computed by PubChem (NCBI)