CAS 2304558-25-4 appears in our catalog under these names: Dbco-peg2-acid, 95%, DBCO-PEG2-acid, DBCO–PEG2–acid, DBCO-PEG2-acid 95%, DBCO-PEG2-acid, 95%, 95%. Offered by: Combi-blocks, TargetMol, GLPBio, Ambeed, Chemat. Available pack sizes: 100mg, 250mg, 2mg, 5mg, 50mg, 1g, 50 mg, 250 mg.
3-[2-[2-[[4-(2-azatricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-yn-2-yl)-4-oxobutanoyl]amino]ethoxy]ethoxy]propanoic acid (CAS 2304558-25-4) is a chemical compound with the molecular formula C26H28N2O6 and a molecular weight of 464.5 g/mol. IUPAC name: 3-[2-[2-[[4-(2-azatricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-yn-2-yl)-4-oxobutanoyl]amino]ethoxy]ethoxy]propanoic acid. InChIKey: IZLCAESRDHFGLF-UHFFFAOYSA-N.
| Molecular formula | C26H28N2O6 |
|---|---|
| Molecular weight | 464.5 g/mol |
| IUPAC name | 3-[2-[2-[[4-(2-azatricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-yn-2-yl)-4-oxobutanoyl]amino]ethoxy]ethoxy]propanoic acid |
| InChIKey | IZLCAESRDHFGLF-UHFFFAOYSA-N |
| SMILES | C1C2=CC=CC=C2C#CC3=CC=CC=C3N1C(=O)CCC(=O)NCCOCCOCCC(=O)O |
Computed by PubChem (NCBI)