CAS 2304634-71-5 appears in our catalog under these names: (1-[(tert-Butoxy)carbonyl]-6-cyano-1h-indol-3-yl)boronic acid, 95%, (1-(tert-Butoxycarbonyl)-6-cyano-1H-indol-3-yl)boronic acid 98%, (1-(tert-Butoxycarbonyl)-6-cyano-1H-indol-3-yl)boronic acid, 98%, 98%, {1-[(tert-butoxy)carbonyl]-6-cyano-1H-indol-3-yl}boronic acid, 98%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 5g, 100mg.
[6-cyano-1-[(2-methylpropan-2-yl)oxycarbonyl]indol-3-yl]boronic acid (CAS 2304634-71-5) is a chemical compound with the molecular formula C14H15BN2O4 and a molecular weight of 286.09 g/mol. IUPAC name: [6-cyano-1-[(2-methylpropan-2-yl)oxycarbonyl]indol-3-yl]boronic acid. InChIKey: FJEQIVPJRILZHZ-UHFFFAOYSA-N.
| Molecular formula | C14H15BN2O4 |
|---|---|
| Molecular weight | 286.09 g/mol |
| IUPAC name | [6-cyano-1-[(2-methylpropan-2-yl)oxycarbonyl]indol-3-yl]boronic acid |
| InChIKey | FJEQIVPJRILZHZ-UHFFFAOYSA-N |
| SMILES | B(C1=CN(C2=C1C=CC(=C2)C#N)C(=O)OC(C)(C)C)(O)O |
Computed by PubChem (NCBI)