CAS 2304635-01-4 appears in our catalog under these names: (5-Fluoro-1-[tris(propan-2-yl)silyl]-1h-indol-4-yl)boronic acid, 95%, (5-Fluoro-1-(triisopropylsilyl)-1H-indol-4-yl)boronic acid, 97%, (5-Fluoro-1-[tris(propan-2-yl)silyl]-1h-indol-4-yl)boronic acid, 94%, 94%, {5-FLUORO-1-[TRIS(PROPAN-2-YL)SILYL]-1H-INDOL-4-YLBORONIC ACID, 94%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 100mg, 500mg.
[5-fluoro-1-tri(propan-2-yl)silylindol-4-yl]boronic acid (CAS 2304635-01-4) is a chemical compound with the molecular formula C17H27BFNO2Si and a molecular weight of 335.3 g/mol. IUPAC name: [5-fluoro-1-tri(propan-2-yl)silylindol-4-yl]boronic acid. InChIKey: ZKSPJZIANXXTCN-UHFFFAOYSA-N.
| Molecular formula | C17H27BFNO2Si |
|---|---|
| Molecular weight | 335.3 g/mol |
| IUPAC name | [5-fluoro-1-tri(propan-2-yl)silylindol-4-yl]boronic acid |
| InChIKey | ZKSPJZIANXXTCN-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC2=C1C=CN2[Si](C(C)C)(C(C)C)C(C)C)F)(O)O |
Computed by PubChem (NCBI)