Products 2304748-21-6

CAS 2304748-21-6 appears in our catalog under these names: (2,3-Dichloro-4-cyanophenyl)boronic acid, 95%, (2,3-Dichloro-4-cyanophenyl)boronic acid, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

(2,3-dichloro-4-cyanophenyl)boronic acid (CAS 2304748-21-6) is a chemical compound with the molecular formula C7H4BCl2NO2 and a molecular weight of 215.83 g/mol. IUPAC name: (2,3-dichloro-4-cyanophenyl)boronic acid. InChIKey: VQETUSSHOFBGDO-UHFFFAOYSA-N.

Identity
Molecular formulaC7H4BCl2NO2
Molecular weight215.83 g/mol
IUPAC name(2,3-dichloro-4-cyanophenyl)boronic acid
InChIKeyVQETUSSHOFBGDO-UHFFFAOYSA-N
SMILESB(C1=C(C(=C(C=C1)C#N)Cl)Cl)(O)O

Computed by PubChem (NCBI)