CAS 2304748-21-6 appears in our catalog under these names: (2,3-Dichloro-4-cyanophenyl)boronic acid, 95%, (2,3-Dichloro-4-cyanophenyl)boronic acid, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
(2,3-dichloro-4-cyanophenyl)boronic acid (CAS 2304748-21-6) is a chemical compound with the molecular formula C7H4BCl2NO2 and a molecular weight of 215.83 g/mol. IUPAC name: (2,3-dichloro-4-cyanophenyl)boronic acid. InChIKey: VQETUSSHOFBGDO-UHFFFAOYSA-N.
| Molecular formula | C7H4BCl2NO2 |
|---|---|
| Molecular weight | 215.83 g/mol |
| IUPAC name | (2,3-dichloro-4-cyanophenyl)boronic acid |
| InChIKey | VQETUSSHOFBGDO-UHFFFAOYSA-N |
| SMILES | B(C1=C(C(=C(C=C1)C#N)Cl)Cl)(O)O |
Computed by PubChem (NCBI)