CAS 2304799-56-0 is the registry number for 5-Iodo-7-tosyl-7H-pyrrolo[2,3-d]pyrimidin-4-amine, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
5-iodo-7-(4-methylphenyl)sulfonylpyrrolo[2,3-d]pyrimidin-4-amine (CAS 2304799-56-0) is a chemical compound with the molecular formula C13H11IN4O2S and a molecular weight of 414.22 g/mol. IUPAC name: 5-iodo-7-(4-methylphenyl)sulfonylpyrrolo[2,3-d]pyrimidin-4-amine. InChIKey: CFNHEIMHJGOTHA-UHFFFAOYSA-N.
| Molecular formula | C13H11IN4O2S |
|---|---|
| Molecular weight | 414.22 g/mol |
| IUPAC name | 5-iodo-7-(4-methylphenyl)sulfonylpyrrolo[2,3-d]pyrimidin-4-amine |
| InChIKey | CFNHEIMHJGOTHA-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)N2C=C(C3=C(N=CN=C32)N)I |
Computed by PubChem (NCBI)