CAS 2304858-84-0 is the registry number for 3-Methoxy-5-methylaniline-d3. Offered by: TRC. Available pack sizes: 100mg.
3-methyl-5-(trideuteriomethoxy)aniline (CAS 2304858-84-0) is a chemical compound with the molecular formula C8H11NO and a molecular weight of 140.20 g/mol. IUPAC name: 3-methyl-5-(trideuteriomethoxy)aniline. InChIKey: SIYIMMXOEYEZHK-BMSJAHLVSA-N.
| Molecular formula | C8H11NO |
|---|---|
| Molecular weight | 140.20 g/mol |
| IUPAC name | 3-methyl-5-(trideuteriomethoxy)aniline |
| InChIKey | SIYIMMXOEYEZHK-BMSJAHLVSA-N |
| SMILES | [2H]C([2H])([2H])OC1=CC(=CC(=C1)N)C |
Computed by PubChem (NCBI)