CAS 2305185-03-7 is the registry number for rac-((2R,6R)-6-Methylpiperidin-2-yl)methanamine dihydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
[(2R,6R)-6-methylpiperidin-2-yl]methanamine;dihydrochloride (CAS 2305185-03-7) is a chemical compound with the molecular formula C7H18Cl2N2 and a molecular weight of 201.13 g/mol. IUPAC name: [(2R,6R)-6-methylpiperidin-2-yl]methanamine;dihydrochloride. InChIKey: MDGXBCYUFFDHEB-GPJOBVNKSA-N.
| Molecular formula | C7H18Cl2N2 |
|---|---|
| Molecular weight | 201.13 g/mol |
| IUPAC name | [(2R,6R)-6-methylpiperidin-2-yl]methanamine;dihydrochloride |
| InChIKey | MDGXBCYUFFDHEB-GPJOBVNKSA-N |
| SMILES | C[C@@H]1CCC[C@@H](N1)CN.Cl.Cl |
Computed by PubChem (NCBI)