CAS 2305202-72-4 is the registry number for rac-Ethyl (3R,4R)-4-methyl-5-oxopyrrolidine-3-carboxylate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Ethyl (3S,4S)-4-methyl-5-oxopyrrolidine-3-carboxylate (CAS 2305202-72-4) is a chemical compound with the molecular formula C8H13NO3 and a molecular weight of 171.19 g/mol. IUPAC name: ethyl (3S,4S)-4-methyl-5-oxopyrrolidine-3-carboxylate. InChIKey: NTNCSUZFSPRCHX-NTSWFWBYSA-N.
| Molecular formula | C8H13NO3 |
|---|---|
| Molecular weight | 171.19 g/mol |
| IUPAC name | ethyl (3S,4S)-4-methyl-5-oxopyrrolidine-3-carboxylate |
| InChIKey | NTNCSUZFSPRCHX-NTSWFWBYSA-N |
| SMILES | CCOC(=O)[C@@H]1CNC(=O)[C@H]1C |
Computed by PubChem (NCBI)