CAS 2305252-76-8 is the registry number for 2-(5-Methylthiophen-2-yl)-1,3-benzothiazol-6-amine dihydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-(5-methylthiophen-2-yl)-1,3-benzothiazol-6-amine;dihydrochloride (CAS 2305252-76-8) is a chemical compound with the molecular formula C12H12Cl2N2S2 and a molecular weight of 319.3 g/mol. IUPAC name: 2-(5-methylthiophen-2-yl)-1,3-benzothiazol-6-amine;dihydrochloride. InChIKey: RLDFAFYCUPKMLX-UHFFFAOYSA-N.
| Molecular formula | C12H12Cl2N2S2 |
|---|---|
| Molecular weight | 319.3 g/mol |
| IUPAC name | 2-(5-methylthiophen-2-yl)-1,3-benzothiazol-6-amine;dihydrochloride |
| InChIKey | RLDFAFYCUPKMLX-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(S1)C2=NC3=C(S2)C=C(C=C3)N.Cl.Cl |
Computed by PubChem (NCBI)