Products 2305253-24-9
CAS 2305253-24-9 is the registry number for tert-Butyl N-({6-oxospiro(3.3)heptan-2-yl}methyl)carbamate. Offered by: Biosynth. Available pack sizes: 0,1g, 0,05g, 0,25g, 0,5g, 1g.
Tert-butyl N-[(2-oxospiro[3.3]heptan-6-yl)methyl]carbamate (CAS 2305253-24-9) is a chemical compound with the molecular formula C13H21NO3 and a molecular weight of 239.31 g/mol. IUPAC name: tert-butyl N-[(2-oxospiro[3.3]heptan-6-yl)methyl]carbamate. InChIKey: DFNCFGDYBYYVRD-UHFFFAOYSA-N.
| Molecular formula | C13H21NO3 |
|---|---|
| Molecular weight | 239.31 g/mol |
| IUPAC name | tert-butyl N-[(2-oxospiro[3.3]heptan-6-yl)methyl]carbamate |
| InChIKey | DFNCFGDYBYYVRD-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCC1CC2(C1)CC(=O)C2 |
Computed by PubChem (NCBI)