CAS 2305253-53-4 appears in our catalog under these names: Lithium [1,2,4]triazolo[4,3-a]pyridine-3-carboxylate 95%, LITHIUM [1,2,4]TRIAZOLO[4,3-A]PYRIDINE-3-CARBOXYLATE, 97%. Offered by: Ambeed, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g.
Lithium [1,2,4]triazolo[4,3-a]pyridine-3-carboxylate (CAS 2305253-53-4) is a chemical compound with the molecular formula C7H4LiN3O2 and a molecular weight of 169.1 g/mol. IUPAC name: lithium [1,2,4]triazolo[4,3-a]pyridine-3-carboxylate. InChIKey: UQXVCLITNXYYDR-UHFFFAOYSA-M.
| Molecular formula | C7H4LiN3O2 |
|---|---|
| Molecular weight | 169.1 g/mol |
| IUPAC name | lithium [1,2,4]triazolo[4,3-a]pyridine-3-carboxylate |
| InChIKey | UQXVCLITNXYYDR-UHFFFAOYSA-M |
| SMILES | [Li+].C1=CC2=NN=C(N2C=C1)C(=O)[O-] |
Computed by PubChem (NCBI)